Products 178439-50-4
CAS 178439-50-4 is the registry number for Agrostophyllidin. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, Get quote.
5,13-dimethoxy-2-oxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4(16),5,7,11(15),12-hexaen-6-ol (CAS 178439-50-4) is a chemical compound with the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. IUPAC name: 5,13-dimethoxy-2-oxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4(16),5,7,11(15),12-hexaen-6-ol. InChIKey: RWCTZGNIHHTMKW-UHFFFAOYSA-N.
| Molecular formula | C17H16O4 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | 5,13-dimethoxy-2-oxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4(16),5,7,11(15),12-hexaen-6-ol |
| InChIKey | RWCTZGNIHHTMKW-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C3C(=C1)OCC4=C3C(=CC(=C4OC)O)CC2 |
Computed by PubChem (NCBI)
Synonyms:
Agrostophyllidin, orb1991261