Products 1784860-29-2
CAS 1784860-29-2 appears in our catalog under these names: 7-Methoxy-2-methyl-2H-indazole-5-carboxylic acid, 7-Methoxy-2-methyl-2H-indazole-5-carboxylic acid, 97%, 97%. Offered by: Biosynth, Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 500mg, 1g, 5g, 10g.
7-methoxy-2-methylindazole-5-carboxylic acid (CAS 1784860-29-2) is a chemical compound with the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. IUPAC name: 7-methoxy-2-methylindazole-5-carboxylic acid. InChIKey: MWLYZICFLQFYRQ-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O3 |
|---|---|
| Molecular weight | 206.20 g/mol |
| IUPAC name | 7-methoxy-2-methylindazole-5-carboxylic acid |
| InChIKey | MWLYZICFLQFYRQ-UHFFFAOYSA-N |
| SMILES | CN1C=C2C=C(C=C(C2=N1)OC)C(=O)O |
Computed by PubChem (NCBI)