CAS 1785074-81-8 appears in our catalog under these names: 3-(1-Methyl-1H-1,2,4-triazol-3-yl)phenol, 95%, 3-(1-Methyl-1H-1,2,4-triazol-3-yl)phenol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-(1-methyl-1,2,4-triazol-3-yl)phenol (CAS 1785074-81-8) is a chemical compound with the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. IUPAC name: 3-(1-methyl-1,2,4-triazol-3-yl)phenol. InChIKey: HWSAPEQEBHRNKM-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O |
|---|---|
| Molecular weight | 175.19 g/mol |
| IUPAC name | 3-(1-methyl-1,2,4-triazol-3-yl)phenol |
| InChIKey | HWSAPEQEBHRNKM-UHFFFAOYSA-N |
| SMILES | CN1C=NC(=N1)C2=CC(=CC=C2)O |
Computed by PubChem (NCBI)