Products 17851-53-5
CAS 17851-53-5 appears in our catalog under these names: Butyl Isobutyl Phthalate, >95% (HPLC), Butyl isobutyl phthalate/ 98.3% (existing batch purity), Butyl isobutyl phthalate, Butyl Isobutyl Phthalate, >98.0%(GC), Butyl isobutyl phthalate 95%. Offered by: TRC, TargetMol, GLPBio, TCI, Ambeed. Available pack sizes: 100mg, 250mg, 10mg, 25mg, 50mg, 500mg, 10mM (in 1ml dmso), 1g.
1-O-butyl 2-O-(2-methylpropyl) benzene-1,2-dicarboxylate (CAS 17851-53-5) is a chemical compound with the molecular formula C16H22O4 and a molecular weight of 278.34 g/mol. IUPAC name: 1-O-butyl 2-O-(2-methylpropyl) benzene-1,2-dicarboxylate. InChIKey: UVIVWIFUPKGWGF-UHFFFAOYSA-N.
| Molecular formula | C16H22O4 |
|---|---|
| Molecular weight | 278.34 g/mol |
| IUPAC name | 1-O-butyl 2-O-(2-methylpropyl) benzene-1,2-dicarboxylate |
| InChIKey | UVIVWIFUPKGWGF-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)C1=CC=CC=C1C(=O)OCC(C)C |
Computed by PubChem (NCBI)
Synonyms:
BUTYL ISOBUTYL PHTHALATE, 1-O-butyl 2-O-(2-methylpropyl) benzene-1,2-dicarboxylate, butyl-isobutyl-phthalate, 1,2-Benzenedicarboxylic acid, butyl 2-methylpropyl ester, Isobutyl n-nutyl phthalate, 1,2-Benzenedicarboxylic acid, 1-butyl 2-(2-methylpropyl) ester, Phthalic acid, butyl isobutyl ester, ButylIsobutylPhthalate, Phthalic acid 1-butyl 2-isobutyl ester, Phthalic acid 1-(2-methylpropyl)2-butyl ester