CAS 1785150-23-3 is the registry number for 2-Chloro-8-quinazolinecarboxylic Acid. Offered by: TRC. Available pack sizes: 250mg.
2-chloroquinazoline-8-carboxylic acid (CAS 1785150-23-3) is a chemical compound with the molecular formula C9H5ClN2O2 and a molecular weight of 208.60 g/mol. IUPAC name: 2-chloroquinazoline-8-carboxylic acid. InChIKey: HFUFHTROPMQNOQ-UHFFFAOYSA-N.
| Molecular formula | C9H5ClN2O2 |
|---|---|
| Molecular weight | 208.60 g/mol |
| IUPAC name | 2-chloroquinazoline-8-carboxylic acid |
| InChIKey | HFUFHTROPMQNOQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=CN=C(N=C2C(=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)