Products 1785359-65-0
CAS 1785359-65-0 appears in our catalog under these names: 5-Bromo-4-chloro-2-methylbenzoic acid, 95%, 5-Bromo-4-chloro-2-methylbenzoic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
5-bromo-4-chloro-2-methylbenzoic acid (CAS 1785359-65-0) is a chemical compound with the molecular formula C8H6BrClO2 and a molecular weight of 249.49 g/mol. IUPAC name: 5-bromo-4-chloro-2-methylbenzoic acid. InChIKey: NPFBIMPPQTYNEM-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO2 |
|---|---|
| Molecular weight | 249.49 g/mol |
| IUPAC name | 5-bromo-4-chloro-2-methylbenzoic acid |
| InChIKey | NPFBIMPPQTYNEM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(=O)O)Br)Cl |
Computed by PubChem (NCBI)