Products 178680-96-1

CAS 178680-96-1 is the registry number for 2-Phenyl-1,3-dioxane-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-phenyl-1,3-dioxane-4-carboxylic acid (CAS 178680-96-1) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: 2-phenyl-1,3-dioxane-4-carboxylic acid. InChIKey: AWRXHWTXLRTSEO-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12O4
Molecular weight208.21 g/mol
IUPAC name2-phenyl-1,3-dioxane-4-carboxylic acid
InChIKeyAWRXHWTXLRTSEO-UHFFFAOYSA-N
SMILESC1COC(OC1C(=O)O)C2=CC=CC=C2

Computed by PubChem (NCBI)