CAS 17874-34-9 is the registry number for 4,6-Dimethyl-8-tert-butylcoumarin. Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 10g, 1g, 50mg.
8-tert-butyl-4,6-dimethylchromen-2-one (CAS 17874-34-9) is a chemical compound with the molecular formula C15H18O2 and a molecular weight of 230.30 g/mol. IUPAC name: 8-tert-butyl-4,6-dimethylchromen-2-one. InChIKey: SIOLFBILQBRZOC-UHFFFAOYSA-N.
| Molecular formula | C15H18O2 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | 8-tert-butyl-4,6-dimethylchromen-2-one |
| InChIKey | SIOLFBILQBRZOC-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1)C(C)(C)C)OC(=O)C=C2C |
Computed by PubChem (NCBI)