Products 178804-18-7
CAS 178804-18-7 appears in our catalog under these names: 2-(4-Aminophenyl)-1,3-Benzothiazol-6-Ol, >95% (HPLC), 6-OH-BTA-0, 2-(4-Aminophenyl)-1,3-Benzothiazol-6-Ol, 98%, 98%. Offered by: TRC, TargetMol, Chemat. Available pack sizes: 50mg, 100mg, 25mg.
2-(4-aminophenyl)-1,3-benzothiazol-6-ol (CAS 178804-18-7) is a chemical compound with the molecular formula C13H10N2OS and a molecular weight of 242.30 g/mol. IUPAC name: 2-(4-aminophenyl)-1,3-benzothiazol-6-ol. InChIKey: KYQOWAHXMWGEJG-UHFFFAOYSA-N.
| Molecular formula | C13H10N2OS |
|---|---|
| Molecular weight | 242.30 g/mol |
| IUPAC name | 2-(4-aminophenyl)-1,3-benzothiazol-6-ol |
| InChIKey | KYQOWAHXMWGEJG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC3=C(S2)C=C(C=C3)O)N |
Computed by PubChem (NCBI)