CAS 178813-77-9 appears in our catalog under these names: 2,6-Dichloro-3-fluorobenzaldehyde, 95%, 2,6-Dichloro-3-fluorobenzaldehyde, 98%, 2,6–Dichloro–3–Fluorobenzaldehyde, 2,6-Dichloro-3-fluorobenzaldehyde 98%, 2,6-DICHLORO-3-FLUOROBENZALDEHYDE, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 100mg.
2,6-dichloro-3-fluorobenzaldehyde (CAS 178813-77-9) is a chemical compound with the molecular formula C7H3Cl2FO and a molecular weight of 193.00 g/mol. IUPAC name: 2,6-dichloro-3-fluorobenzaldehyde. InChIKey: KLSFEXQUIFNMSV-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO |
|---|---|
| Molecular weight | 193.00 g/mol |
| IUPAC name | 2,6-dichloro-3-fluorobenzaldehyde |
| InChIKey | KLSFEXQUIFNMSV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)Cl)C=O)Cl |
Computed by PubChem (NCBI)