CAS 179055-98-2 is the registry number for [4-(5-Methyl-1,3,4-oxadiazol-2-yl)phenyl]methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]methanol (CAS 179055-98-2) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: [4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]methanol. InChIKey: WWIIYKUYDLFHTK-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | [4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]methanol |
| InChIKey | WWIIYKUYDLFHTK-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(O1)C2=CC=C(C=C2)CO |
Computed by PubChem (NCBI)