CAS 179057-14-8 appears in our catalog under these names: Methyl 4-(5-Oxazolyl)benzoate, 98%, 98%, Methyl 4-(1,3-Oxazol-5-yl)benzoate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 10g.
Methyl 4-(1,3-oxazol-5-yl)benzoate (CAS 179057-14-8) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: methyl 4-(1,3-oxazol-5-yl)benzoate. InChIKey: LFNHUUMUCVZCGY-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | methyl 4-(1,3-oxazol-5-yl)benzoate |
| InChIKey | LFNHUUMUCVZCGY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=CN=CO2 |
Computed by PubChem (NCBI)