Products 1793055-05-6
CAS 1793055-05-6 appears in our catalog under these names: Permethrin Impurity 1-13C6, 3-(Phenoxy-13C6)benzoic Acid, >95% (HPLC), 3–Phenoxybenzoic acid–13C6, 3-Phenoxybenzoic Acid-13C6, 3-Phenoxybenzoic acid-13C6, 99.29%. Offered by: Chemat Brand, TRC, GLPBio, Chemat, MedChemExpress. Available pack sizes: on request, 1mg, 5mg, 1 mg, 1x10mg.
3-((1,2,3,4,5,6-13C6)cyclohexatrienyloxy)benzoic acid (CAS 1793055-05-6) is a chemical compound with the molecular formula C13H10O3 and a molecular weight of 220.17 g/mol. IUPAC name: 3-((1,2,3,4,5,6-13C6)cyclohexatrienyloxy)benzoic acid. InChIKey: NXTDJHZGHOFSQG-UJVDBDNBSA-N.
| Molecular formula | C13H10O3 |
|---|---|
| Molecular weight | 220.17 g/mol |
| IUPAC name | 3-((1,2,3,4,5,6-13C6)cyclohexatrienyloxy)benzoic acid |
| InChIKey | NXTDJHZGHOFSQG-UJVDBDNBSA-N |
| SMILES | C1=CC(=CC(=C1)O[13C]2=[13CH][13CH]=[13CH][13CH]=[13CH]2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-Phenoxybenzoic acid-13C6, 3-Phenoxy-13C6-benzoic acid, 3-Phenoxy-13C6 Benzoic Acid, 3-(Phenoxy-13C6)benzoic Acid, 3-((1,2,3,4,5,6-13C6)cyclohexatrienyloxy)benzoic acid, 3-PBA-13C6; m-(Phenyloxy-13C6)benzoic Acid; m-Phenoxybenzoic Acid-13C6, 3-Phenoxy-13C6-benzoic acid, PESTANAL(R), analytical standard