Products 17934-08-6
CAS 17934-08-6 is the registry number for (E)-Eucomin. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3E)-5,7-dihydroxy-3-[(4-methoxyphenyl)methylidene]chromen-4-one (CAS 17934-08-6) is a chemical compound with the molecular formula C17H14O5 and a molecular weight of 298.29 g/mol. IUPAC name: (3E)-5,7-dihydroxy-3-[(4-methoxyphenyl)methylidene]chromen-4-one. InChIKey: MNFFPBYXUIMSFC-IZZDOVSWSA-N.
| Molecular formula | C17H14O5 |
|---|---|
| Molecular weight | 298.29 g/mol |
| IUPAC name | (3E)-5,7-dihydroxy-3-[(4-methoxyphenyl)methylidene]chromen-4-one |
| InChIKey | MNFFPBYXUIMSFC-IZZDOVSWSA-N |
| SMILES | COC1=CC=C(C=C1)/C=C/2\COC3=CC(=CC(=C3C2=O)O)O |
Computed by PubChem (NCBI)