CAS 179386-43-7 is the registry number for Sumanirole. Offered by: MedChemExpress. Available pack sizes: Get quote.
(10R)-10-(methylamino)-1,3-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one (CAS 179386-43-7) is a chemical compound with the molecular formula C11H13N3O and a molecular weight of 203.24 g/mol. IUPAC name: (10R)-10-(methylamino)-1,3-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one. InChIKey: RKZSNTNMEFVBDT-MRVPVSSYSA-N.
| Molecular formula | C11H13N3O |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | (10R)-10-(methylamino)-1,3-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one |
| InChIKey | RKZSNTNMEFVBDT-MRVPVSSYSA-N |
| SMILES | CN[C@@H]1CC2=C3C(=CC=C2)NC(=O)N3C1 |
Computed by PubChem (NCBI)