Products 1794756-28-7
CAS 1794756-28-7 appears in our catalog under these names: Monopentyl Phthalate-d4, >95% (HPLC), mono-n-Pentyl Phthalate-3,4,5,6-d4, 99 atom % D, min 98% Chemical Purity, Mono-n-Pentyl Phthalate-3,4,5,6-d4. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 50mg, 5mg, 0,1g, 0,05g, 50 mg, 5 mg.
2,3,4,5-tetradeuterio-6-pentoxycarbonylbenzoic acid (CAS 1794756-28-7) is a chemical compound with the molecular formula C13H16O4 and a molecular weight of 240.29 g/mol. IUPAC name: 2,3,4,5-tetradeuterio-6-pentoxycarbonylbenzoic acid. InChIKey: FPGPRAKRYDSZAW-YBNXMSKUSA-N.
| Molecular formula | C13H16O4 |
|---|---|
| Molecular weight | 240.29 g/mol |
| IUPAC name | 2,3,4,5-tetradeuterio-6-pentoxycarbonylbenzoic acid |
| InChIKey | FPGPRAKRYDSZAW-YBNXMSKUSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)O)C(=O)OCCCCC)[2H])[2H] |
Computed by PubChem (NCBI)