Products 1795020-91-5
CAS 1795020-91-5 appears in our catalog under these names: Monopropyl Phthalate-d4, >95% (HPLC), mono-n-Propyl Phthalate-3,4,5,6-d4, 99 atom % D, min 98% Chemical Purity, Mono-n-Propyl Phthalate-3,4,5,6-d4. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 50mg, 5mg, 0,1g, 0,05g, 5 mg.
2,3,4,5-tetradeuterio-6-propoxycarbonylbenzoic acid (CAS 1795020-91-5) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 212.23 g/mol. IUPAC name: 2,3,4,5-tetradeuterio-6-propoxycarbonylbenzoic acid. InChIKey: NFOQRIXSEYVCJP-LNFUJOGGSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 212.23 g/mol |
| IUPAC name | 2,3,4,5-tetradeuterio-6-propoxycarbonylbenzoic acid |
| InChIKey | NFOQRIXSEYVCJP-LNFUJOGGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)O)C(=O)OCCC)[2H])[2H] |
Computed by PubChem (NCBI)