Products 1795283-70-3

CAS 1795283-70-3 appears in our catalog under these names: 1,2-Dimethylpyrrolidine-3-carboxylic acid hydrochloride, 1,2-Dimethylpyrrolidine-3-carboxylic acid hydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.

1,2-dimethylpyrrolidine-3-carboxylic acid;hydrochloride (CAS 1795283-70-3) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: 1,2-dimethylpyrrolidine-3-carboxylic acid;hydrochloride. InChIKey: ZDJKUVBORQJPLQ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H14ClNO2
Molecular weight179.64 g/mol
IUPAC name1,2-dimethylpyrrolidine-3-carboxylic acid;hydrochloride
InChIKeyZDJKUVBORQJPLQ-UHFFFAOYSA-N
SMILESCC1C(CCN1C)C(=O)O.Cl

Computed by PubChem (NCBI)