CAS 179691-97-5 appears in our catalog under these names: 5-LOX-IN-2, 98%, 5-LOX-IN-2 98%, 5-LOX-IN-2, 98.12%, 2,5–Dihydroxycinnamic Acid phenethyl ester, 5-LOX-IN-2/ 99.18% (existing batch purity). Offered by: AmBeed, MedChemExpress, GLPBio, TargetMol, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 25 mg, 10 mg, 5 mg.
2-phenylethyl (E)-3-(2,5-dihydroxyphenyl)prop-2-enoate (CAS 179691-97-5) is a chemical compound with the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. IUPAC name: 2-phenylethyl (E)-3-(2,5-dihydroxyphenyl)prop-2-enoate. InChIKey: OQKRMXDGEFRBAJ-RMKNXTFCSA-N.
| Molecular formula | C17H16O4 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | 2-phenylethyl (E)-3-(2,5-dihydroxyphenyl)prop-2-enoate |
| InChIKey | OQKRMXDGEFRBAJ-RMKNXTFCSA-N |
| SMILES | C1=CC=C(C=C1)CCOC(=O)/C=C/C2=C(C=CC(=C2)O)O |
Computed by PubChem (NCBI)