CAS 1797943-59-9 appears in our catalog under these names: 2–(4–(trifluoromethoxy)phenyl)propan–2–amine hydrochloride, 2-(4-(Trifluoromethoxy)phenyl)propan-2-amine hydrochloride, 2-[4-(TRIFLUOROMETHOXY)PHENYL]PROPAN-2-AMINE HYDROCHLORIDE, 2-[4-(trifluoromethoxy)phenyl]propan-2-amine hydrochloride, 95%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 500mg, 0,5g, 50mg.
2-[4-(trifluoromethoxy)phenyl]propan-2-amine;hydrochloride (CAS 1797943-59-9) is a chemical compound with the molecular formula C10H13ClF3NO and a molecular weight of 255.66 g/mol. IUPAC name: 2-[4-(trifluoromethoxy)phenyl]propan-2-amine;hydrochloride. InChIKey: HFTXCXIQRNDZAQ-UHFFFAOYSA-N.
| Molecular formula | C10H13ClF3NO |
|---|---|
| Molecular weight | 255.66 g/mol |
| IUPAC name | 2-[4-(trifluoromethoxy)phenyl]propan-2-amine;hydrochloride |
| InChIKey | HFTXCXIQRNDZAQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)OC(F)(F)F)N.Cl |
Computed by PubChem (NCBI)