Products 1798110-01-6
CAS 1798110-01-6 appears in our catalog under these names: Etoricoxib Impurity 6, Etoricoxib Impurity 36, Etoricoxib Impurity 49. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-(4-methylsulfonylphenyl)-1-morpholin-4-ylethanone (CAS 1798110-01-6) is a chemical compound with the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. IUPAC name: 2-(4-methylsulfonylphenyl)-1-morpholin-4-ylethanone. InChIKey: YYTFTDTZOCTUAO-UHFFFAOYSA-N.
| Molecular formula | C13H17NO4S |
|---|---|
| Molecular weight | 283.35 g/mol |
| IUPAC name | 2-(4-methylsulfonylphenyl)-1-morpholin-4-ylethanone |
| InChIKey | YYTFTDTZOCTUAO-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)CC(=O)N2CCOCC2 |
Computed by PubChem (NCBI)