CAS 1798293-04-5 is the registry number for 9-Chloro-dibenzo(b,f)(1,4)thiazepin-11(10H)-one. Offered by: TRC. Available pack sizes: 100mg, 25mg, 50mg.
4-chloro-5H-benzo[b][1,4]benzothiazepin-6-one (CAS 1798293-04-5) is a chemical compound with the molecular formula C13H8ClNOS and a molecular weight of 261.73 g/mol. IUPAC name: 4-chloro-5H-benzo[b][1,4]benzothiazepin-6-one. InChIKey: WGEJTQBZTQFFAE-UHFFFAOYSA-N.
| Molecular formula | C13H8ClNOS |
|---|---|
| Molecular weight | 261.73 g/mol |
| IUPAC name | 4-chloro-5H-benzo[b][1,4]benzothiazepin-6-one |
| InChIKey | WGEJTQBZTQFFAE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NC3=C(S2)C=CC=C3Cl |
Computed by PubChem (NCBI)