CAS 18956-87-1 appears in our catalog under these names: Phenothiazine-10-carbonyl chloride, 95%, Phenothiazine–10–carbonyl chloride. Offered by: AmBeed, GLPBio. Available pack sizes: 5g, 1g, 100g, 25g, 500g.
Phenothiazine-10-carbonyl chloride (CAS 18956-87-1) is a chemical compound with the molecular formula C13H8ClNOS and a molecular weight of 261.73 g/mol. IUPAC name: phenothiazine-10-carbonyl chloride. InChIKey: MJRIZSDRKPPHTK-UHFFFAOYSA-N.
| Molecular formula | C13H8ClNOS |
|---|---|
| Molecular weight | 261.73 g/mol |
| IUPAC name | phenothiazine-10-carbonyl chloride |
| InChIKey | MJRIZSDRKPPHTK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N(C3=CC=CC=C3S2)C(=O)Cl |
Computed by PubChem (NCBI)