CAS 6265-97-0 is the registry number for 2-(benzo[d]thiazol-2-yl)-4-chlorophenol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(1,3-benzothiazol-2-yl)-4-chlorophenol (CAS 6265-97-0) is a chemical compound with the molecular formula C13H8ClNOS and a molecular weight of 261.73 g/mol. IUPAC name: 2-(1,3-benzothiazol-2-yl)-4-chlorophenol. InChIKey: NTSGEVXMOPCWCT-UHFFFAOYSA-N.
| Molecular formula | C13H8ClNOS |
|---|---|
| Molecular weight | 261.73 g/mol |
| IUPAC name | 2-(1,3-benzothiazol-2-yl)-4-chlorophenol |
| InChIKey | NTSGEVXMOPCWCT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)C3=C(C=CC(=C3)Cl)O |
Computed by PubChem (NCBI)