CAS 749906-91-0 appears in our catalog under these names: 4-(1,3-Benzothiazol-2-yl)-2-chlorophenol, 95%, 4-(1,3-Benzothiazol-2-yl)-2-chlorophenol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
4-(1,3-benzothiazol-2-yl)-2-chlorophenol (CAS 749906-91-0) is a chemical compound with the molecular formula C13H8ClNOS and a molecular weight of 261.73 g/mol. IUPAC name: 4-(1,3-benzothiazol-2-yl)-2-chlorophenol. InChIKey: WDSGSVSKGWEOSG-UHFFFAOYSA-N.
| Molecular formula | C13H8ClNOS |
|---|---|
| Molecular weight | 261.73 g/mol |
| IUPAC name | 4-(1,3-benzothiazol-2-yl)-2-chlorophenol |
| InChIKey | WDSGSVSKGWEOSG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)C3=CC(=C(C=C3)O)Cl |
Computed by PubChem (NCBI)