CAS 2727-25-5 is the registry number for 4-(5-Chloro-1,3-benzothiazol-2-yl)phenol, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-(5-chloro-1,3-benzothiazol-2-yl)phenol (CAS 2727-25-5) is a chemical compound with the molecular formula C13H8ClNOS and a molecular weight of 261.73 g/mol. IUPAC name: 4-(5-chloro-1,3-benzothiazol-2-yl)phenol. InChIKey: YKJLZMASBAHCRD-UHFFFAOYSA-N.
| Molecular formula | C13H8ClNOS |
|---|---|
| Molecular weight | 261.73 g/mol |
| IUPAC name | 4-(5-chloro-1,3-benzothiazol-2-yl)phenol |
| InChIKey | YKJLZMASBAHCRD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC3=C(S2)C=CC(=C3)Cl)O |
Computed by PubChem (NCBI)