Products 1799580-65-6

CAS 1799580-65-6 is the registry number for 2-(5-Methoxy-pyridin-3-yl)-ethylamine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

2-(5-methoxy-3-pyridinyl)ethanamine;dihydrochloride (CAS 1799580-65-6) is a chemical compound with the molecular formula C8H14Cl2N2O and a molecular weight of 225.11 g/mol. IUPAC name: 2-(5-methoxy-3-pyridinyl)ethanamine;dihydrochloride. InChIKey: USQSOFQDEWPPIY-UHFFFAOYSA-N.

Identity
Molecular formulaC8H14Cl2N2O
Molecular weight225.11 g/mol
IUPAC name2-(5-methoxy-3-pyridinyl)ethanamine;dihydrochloride
InChIKeyUSQSOFQDEWPPIY-UHFFFAOYSA-N
SMILESCOC1=CN=CC(=C1)CCN.Cl.Cl

Computed by PubChem (NCBI)