CAS 1914157-92-8 appears in our catalog under these names: (R)-1-(2-Methoxypyridin-4-yl)ethanamine dihydrochloride, 95%, (R)-1-(2-Methoxypyridin-4-yl)ethanamine dihydrochloride, 95+%, (R)–1–(2–Methoxypyridin–4–yl)ethanamine dihydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 100mg, 250mg, 1g.
(1R)-1-(2-methoxy-4-pyridinyl)ethanamine;dihydrochloride (CAS 1914157-92-8) is a chemical compound with the molecular formula C8H14Cl2N2O and a molecular weight of 225.11 g/mol. IUPAC name: (1R)-1-(2-methoxy-4-pyridinyl)ethanamine;dihydrochloride. InChIKey: IHKGPAMFFJTIDG-QYCVXMPOSA-N.
| Molecular formula | C8H14Cl2N2O |
|---|---|
| Molecular weight | 225.11 g/mol |
| IUPAC name | (1R)-1-(2-methoxy-4-pyridinyl)ethanamine;dihydrochloride |
| InChIKey | IHKGPAMFFJTIDG-QYCVXMPOSA-N |
| SMILES | C[C@H](C1=CC(=NC=C1)OC)N.Cl.Cl |
Computed by PubChem (NCBI)