CAS 1864062-33-8 appears in our catalog under these names: 3-(1,3-Oxazol-5-yl)piperidine dihydrochloride, 95%, 3-(1,3-Oxazol-5-yl)piperidine dihydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 1g, 250mg, 0,5g, 50mg.
5-piperidin-3-yl-1,3-oxazole;dihydrochloride (CAS 1864062-33-8) is a chemical compound with the molecular formula C8H14Cl2N2O and a molecular weight of 225.11 g/mol. IUPAC name: 5-piperidin-3-yl-1,3-oxazole;dihydrochloride. InChIKey: OYUJSVODSWLBOB-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N2O |
|---|---|
| Molecular weight | 225.11 g/mol |
| IUPAC name | 5-piperidin-3-yl-1,3-oxazole;dihydrochloride |
| InChIKey | OYUJSVODSWLBOB-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)C2=CN=CO2.Cl.Cl |
Computed by PubChem (NCBI)