Products 2138235-97-7
CAS 2138235-97-7 appears in our catalog under these names: 2-(aminomethyl)-3,5-dimethyl-1,4-dihydropyridin-4-one dihydrochloride, 95%, 2-(Aminomethyl)-3,5-dimethylpyridin-4(1H)-one dihydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-(aminomethyl)-3,5-dimethyl-1H-pyridin-4-one;dihydrochloride (CAS 2138235-97-7) is a chemical compound with the molecular formula C8H14Cl2N2O and a molecular weight of 225.11 g/mol. IUPAC name: 2-(aminomethyl)-3,5-dimethyl-1H-pyridin-4-one;dihydrochloride. InChIKey: JYLNDQHVMLDHMI-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N2O |
|---|---|
| Molecular weight | 225.11 g/mol |
| IUPAC name | 2-(aminomethyl)-3,5-dimethyl-1H-pyridin-4-one;dihydrochloride |
| InChIKey | JYLNDQHVMLDHMI-UHFFFAOYSA-N |
| SMILES | CC1=CNC(=C(C1=O)C)CN.Cl.Cl |
Computed by PubChem (NCBI)