CAS 1860028-30-3 appears in our catalog under these names: 3-(Aminomethyl)-4,6-dimethyl-1,2-dihydropyridin-2-one dihydrochloride, 95%, 3-(Aminomethyl)-4,6-dimethylpyridin-2(1H)-one dihydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g, 25g, 10g.
3-(aminomethyl)-4,6-dimethyl-1H-pyridin-2-one;dihydrochloride (CAS 1860028-30-3) is a chemical compound with the molecular formula C8H14Cl2N2O and a molecular weight of 225.11 g/mol. IUPAC name: 3-(aminomethyl)-4,6-dimethyl-1H-pyridin-2-one;dihydrochloride. InChIKey: AIVOQFPFADFMKI-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N2O |
|---|---|
| Molecular weight | 225.11 g/mol |
| IUPAC name | 3-(aminomethyl)-4,6-dimethyl-1H-pyridin-2-one;dihydrochloride |
| InChIKey | AIVOQFPFADFMKI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=O)N1)CN)C.Cl.Cl |
Computed by PubChem (NCBI)