Products 1799661-51-0

CAS 1799661-51-0 is the registry number for N3-L-Lys(Alloc)-OH*DCHA. Offered by: Iris Biotech. Available pack sizes: 1g, 5g, 25g, 500mg.

Structural formula: {0} (CAS {1})

(2S)-2-azido-6-(prop-2-enoxycarbonylamino)hexanoic acid (CAS 1799661-51-0) is a chemical compound with the molecular formula C10H16N4O4 and a molecular weight of 256.26 g/mol. IUPAC name: (2S)-2-azido-6-(prop-2-enoxycarbonylamino)hexanoic acid. InChIKey: XEVUTMKVUWJEQX-QMMMGPOBSA-N.

Identity
Molecular formulaC10H16N4O4
Molecular weight256.26 g/mol
IUPAC name(2S)-2-azido-6-(prop-2-enoxycarbonylamino)hexanoic acid
InChIKeyXEVUTMKVUWJEQX-QMMMGPOBSA-N
SMILESC=CCOC(=O)NCCCC[C@@H](C(=O)O)N=[N+]=[N-]

Computed by PubChem (NCBI)