CAS 1799661-51-0 is the registry number for N3-L-Lys(Alloc)-OH*DCHA. Offered by: Iris Biotech. Available pack sizes: 1g, 5g, 25g, 500mg.
(2S)-2-azido-6-(prop-2-enoxycarbonylamino)hexanoic acid (CAS 1799661-51-0) is a chemical compound with the molecular formula C10H16N4O4 and a molecular weight of 256.26 g/mol. IUPAC name: (2S)-2-azido-6-(prop-2-enoxycarbonylamino)hexanoic acid. InChIKey: XEVUTMKVUWJEQX-QMMMGPOBSA-N.
| Molecular formula | C10H16N4O4 |
|---|---|
| Molecular weight | 256.26 g/mol |
| IUPAC name | (2S)-2-azido-6-(prop-2-enoxycarbonylamino)hexanoic acid |
| InChIKey | XEVUTMKVUWJEQX-QMMMGPOBSA-N |
| SMILES | C=CCOC(=O)NCCCC[C@@H](C(=O)O)N=[N+]=[N-] |
Computed by PubChem (NCBI)