Products 83656-38-6
CAS 83656-38-6 appears in our catalog under these names: Ipramidil (C80–1324), Ipramidil, Ipramidil, 98.0%. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 10mg, 20mg, 5mg, 50mg, 25mg, Get quote.
2-oxido-3-N,4-N-di(propan-2-yl)-1,2,5-oxadiazol-2-ium-3,4-dicarboxamide (CAS 83656-38-6) is a chemical compound with the molecular formula C10H16N4O4 and a molecular weight of 256.26 g/mol. IUPAC name: 2-oxido-3-N,4-N-di(propan-2-yl)-1,2,5-oxadiazol-2-ium-3,4-dicarboxamide. InChIKey: JSKUFGFVEPNZDX-UHFFFAOYSA-N.
| Molecular formula | C10H16N4O4 |
|---|---|
| Molecular weight | 256.26 g/mol |
| IUPAC name | 2-oxido-3-N,4-N-di(propan-2-yl)-1,2,5-oxadiazol-2-ium-3,4-dicarboxamide |
| InChIKey | JSKUFGFVEPNZDX-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)C1=NO[N+](=C1C(=O)NC(C)C)[O-] |
Computed by PubChem (NCBI)