CAS 2167676-04-0 is the registry number for 4-({((tert-Butoxy)carbonyl)amino}methyl)-1-methyl-1H-1,2,3-triazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-methyl-5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]triazole-4-carboxylic acid (CAS 2167676-04-0) is a chemical compound with the molecular formula C10H16N4O4 and a molecular weight of 256.26 g/mol. IUPAC name: 3-methyl-5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]triazole-4-carboxylic acid. InChIKey: BNRNFGLNBBCWQF-UHFFFAOYSA-N.
| Molecular formula | C10H16N4O4 |
|---|---|
| Molecular weight | 256.26 g/mol |
| IUPAC name | 3-methyl-5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]triazole-4-carboxylic acid |
| InChIKey | BNRNFGLNBBCWQF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=C(N(N=N1)C)C(=O)O |
Computed by PubChem (NCBI)