Products 1799726-78-5
CAS 1799726-78-5 is the registry number for 5-Chloro-1H-pyrrolo[3,2-b]pyridine-2-carboxaldehyde, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-chloro-1H-pyrrolo[3,2-b]pyridine-2-carbaldehyde (CAS 1799726-78-5) is a chemical compound with the molecular formula C8H5ClN2O and a molecular weight of 180.59 g/mol. IUPAC name: 5-chloro-1H-pyrrolo[3,2-b]pyridine-2-carbaldehyde. InChIKey: LDTSBVSPLUCNAJ-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 5-chloro-1H-pyrrolo[3,2-b]pyridine-2-carbaldehyde |
| InChIKey | LDTSBVSPLUCNAJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1NC(=C2)C=O)Cl |
Computed by PubChem (NCBI)