CAS 1800305-79-6 appears in our catalog under these names: Methyl 1-hydroxy-1,3-dihydrobenzo(c)(1,2)oxaborole-6-carboxylate, 97%, Methyl 1-hydroxy-1,3-dihydro-2,1-benzoxaborole-6-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Methyl 1-hydroxy-3H-2,1-benzoxaborole-6-carboxylate (CAS 1800305-79-6) is a chemical compound with the molecular formula C9H9BO4 and a molecular weight of 191.98 g/mol. IUPAC name: methyl 1-hydroxy-3H-2,1-benzoxaborole-6-carboxylate. InChIKey: QHFLKHVMUGQHGA-UHFFFAOYSA-N.
| Molecular formula | C9H9BO4 |
|---|---|
| Molecular weight | 191.98 g/mol |
| IUPAC name | methyl 1-hydroxy-3H-2,1-benzoxaborole-6-carboxylate |
| InChIKey | QHFLKHVMUGQHGA-UHFFFAOYSA-N |
| SMILES | B1(C2=C(CO1)C=CC(=C2)C(=O)OC)O |
Computed by PubChem (NCBI)