CAS 2304634-85-1 appears in our catalog under these names: 1-Hydroxy-3,4-dihydro-1h-benzo[c][1,2]oxaborinine-8-carboxylic acid, 95%, 1-Hydroxy-3,4-dihydro-1H-benzo(c)(1,2)oxaborinine-8-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
1-hydroxy-3,4-dihydro-2,1-benzoxaborinine-8-carboxylic acid (CAS 2304634-85-1) is a chemical compound with the molecular formula C9H9BO4 and a molecular weight of 191.98 g/mol. IUPAC name: 1-hydroxy-3,4-dihydro-2,1-benzoxaborinine-8-carboxylic acid. InChIKey: SVTGKJGBXPASEH-UHFFFAOYSA-N.
| Molecular formula | C9H9BO4 |
|---|---|
| Molecular weight | 191.98 g/mol |
| IUPAC name | 1-hydroxy-3,4-dihydro-2,1-benzoxaborinine-8-carboxylic acid |
| InChIKey | SVTGKJGBXPASEH-UHFFFAOYSA-N |
| SMILES | B1(C2=C(CCO1)C=CC=C2C(=O)O)O |
Computed by PubChem (NCBI)