Products 2006313-17-1

CAS 2006313-17-1 is the registry number for 2-Hydroxy-3,4-dihydro-2H-benzo[e][1,2]oxaborinine-8-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (CAS 2006313-17-1) is a chemical compound with the molecular formula C9H9BO4 and a molecular weight of 191.98 g/mol. IUPAC name: 2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid. InChIKey: CDKSGILZHBQLRD-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9BO4
Molecular weight191.98 g/mol
IUPAC name2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid
InChIKeyCDKSGILZHBQLRD-UHFFFAOYSA-N
SMILESB1(CCC2=C(O1)C(=CC=C2)C(=O)O)O

Computed by PubChem (NCBI)