CAS 2006313-17-1 is the registry number for 2-Hydroxy-3,4-dihydro-2H-benzo[e][1,2]oxaborinine-8-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (CAS 2006313-17-1) is a chemical compound with the molecular formula C9H9BO4 and a molecular weight of 191.98 g/mol. IUPAC name: 2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid. InChIKey: CDKSGILZHBQLRD-UHFFFAOYSA-N.
| Molecular formula | C9H9BO4 |
|---|---|
| Molecular weight | 191.98 g/mol |
| IUPAC name | 2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| InChIKey | CDKSGILZHBQLRD-UHFFFAOYSA-N |
| SMILES | B1(CCC2=C(O1)C(=CC=C2)C(=O)O)O |
Computed by PubChem (NCBI)