CAS 2246729-94-0 is the registry number for 5,10,13-Trioxa-4-boratricyclo(7.4.0.0,3,7)trideca-1,3(7),8-trien-4-ol, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1-hydroxy-6,7-dihydro-3H-oxaborolo[3,4-g][1,4]benzodioxine (CAS 2246729-94-0) is a chemical compound with the molecular formula C9H9BO4 and a molecular weight of 191.98 g/mol. IUPAC name: 1-hydroxy-6,7-dihydro-3H-oxaborolo[3,4-g][1,4]benzodioxine. InChIKey: KJUWRQGZSJYDCD-UHFFFAOYSA-N.
| Molecular formula | C9H9BO4 |
|---|---|
| Molecular weight | 191.98 g/mol |
| IUPAC name | 1-hydroxy-6,7-dihydro-3H-oxaborolo[3,4-g][1,4]benzodioxine |
| InChIKey | KJUWRQGZSJYDCD-UHFFFAOYSA-N |
| SMILES | B1(C2=CC3=C(C=C2CO1)OCCO3)O |
Computed by PubChem (NCBI)