Products 952737-54-1
CAS 952737-54-1 appears in our catalog under these names: (6–Methoxybenzofuran–2–yl)boronic acid, (6-Methoxybenzofuran-2-yl)boronic acid, 97%, 97%, (6-Methoxybenzofuran-2-yl)boronic acid, 95%, (6-Methoxybenzofuran-2-yl)boronic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 500mg, 5g.
(6-methoxy-1-benzofuran-2-yl)boronic acid (CAS 952737-54-1) is a chemical compound with the molecular formula C9H9BO4 and a molecular weight of 191.98 g/mol. IUPAC name: (6-methoxy-1-benzofuran-2-yl)boronic acid. InChIKey: MPLLPTYEVKJTJR-UHFFFAOYSA-N.
| Molecular formula | C9H9BO4 |
|---|---|
| Molecular weight | 191.98 g/mol |
| IUPAC name | (6-methoxy-1-benzofuran-2-yl)boronic acid |
| InChIKey | MPLLPTYEVKJTJR-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(O1)C=C(C=C2)OC)(O)O |
Computed by PubChem (NCBI)