Products 180031-16-7
CAS 180031-16-7 is the registry number for 4-chloro-3-hydroxy-5-nitrobenzonitrile, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g.
4-chloro-3-hydroxy-5-nitrobenzonitrile (CAS 180031-16-7) is a chemical compound with the molecular formula C7H3ClN2O3 and a molecular weight of 198.56 g/mol. IUPAC name: 4-chloro-3-hydroxy-5-nitrobenzonitrile. InChIKey: WHHQXQQHGHZHAG-UHFFFAOYSA-N.
| Molecular formula | C7H3ClN2O3 |
|---|---|
| Molecular weight | 198.56 g/mol |
| IUPAC name | 4-chloro-3-hydroxy-5-nitrobenzonitrile |
| InChIKey | WHHQXQQHGHZHAG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])Cl)O)C#N |
Computed by PubChem (NCBI)