CAS 1801551-41-6 is the registry number for 2-(9H-Carbazol-4-yloxy)-ethenol. Offered by: TRC. Available pack sizes: 250mg.
(E)-2-(9H-carbazol-4-yloxy)ethenol (CAS 1801551-41-6) is a chemical compound with the molecular formula C14H11NO2 and a molecular weight of 225.24 g/mol. IUPAC name: (E)-2-(9H-carbazol-4-yloxy)ethenol. InChIKey: FTFXMKQAAJDGDE-CMDGGOBGSA-N.
| Molecular formula | C14H11NO2 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | (E)-2-(9H-carbazol-4-yloxy)ethenol |
| InChIKey | FTFXMKQAAJDGDE-CMDGGOBGSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C=CC=C3O/C=C/O |
Computed by PubChem (NCBI)