CAS 1801627-53-1 appears in our catalog under these names: ((2R,3R)-3-Hydroxytetrahydrofuran-2-yl)methyl 4-methylbenzoate, 98%, ((2R,3R)–3–Hydroxytetrahydrofuran–2–yl)methyl 4–methylbenzoate, [(2R,3R)-3-hydroxytetrahydrofuran-2-yl]methyl 4-methylbenzoate, 97%, 97%, [(2R,3R)-3-Hydroxytetrahydrofuran-2-yl]methyl 4-methylbenzoate, 97%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 100mg, 250mg, 500mg.
[(2R,3R)-3-hydroxyoxolan-2-yl]methyl 4-methylbenzoate (CAS 1801627-53-1) is a chemical compound with the molecular formula C13H16O4 and a molecular weight of 236.26 g/mol. IUPAC name: [(2R,3R)-3-hydroxyoxolan-2-yl]methyl 4-methylbenzoate. InChIKey: FJEYWANPLCAVOX-VXGBXAGGSA-N.
| Molecular formula | C13H16O4 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | [(2R,3R)-3-hydroxyoxolan-2-yl]methyl 4-methylbenzoate |
| InChIKey | FJEYWANPLCAVOX-VXGBXAGGSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)OC[C@@H]2[C@@H](CCO2)O |
Computed by PubChem (NCBI)