Products 1802149-36-5
CAS 1802149-36-5 is the registry number for 6-bromo-3,3-difluoro-1-methylindol-2-one, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
6-bromo-3,3-difluoro-1-methylindol-2-one (CAS 1802149-36-5) is a chemical compound with the molecular formula C9H6BrF2NO and a molecular weight of 262.05 g/mol. IUPAC name: 6-bromo-3,3-difluoro-1-methylindol-2-one. InChIKey: CHZZSHUQVZNQTP-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF2NO |
|---|---|
| Molecular weight | 262.05 g/mol |
| IUPAC name | 6-bromo-3,3-difluoro-1-methylindol-2-one |
| InChIKey | CHZZSHUQVZNQTP-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)Br)C(C1=O)(F)F |
Computed by PubChem (NCBI)