CAS 1802149-48-9 is the registry number for 5-Bromo-3-isopropyl-1,3-benzoxazol-2(3h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-bromo-3-propan-2-yl-1,3-benzoxazol-2-one (CAS 1802149-48-9) is a chemical compound with the molecular formula C10H10BrNO2 and a molecular weight of 256.10 g/mol. IUPAC name: 5-bromo-3-propan-2-yl-1,3-benzoxazol-2-one. InChIKey: IRGRAVNDWCDPML-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO2 |
|---|---|
| Molecular weight | 256.10 g/mol |
| IUPAC name | 5-bromo-3-propan-2-yl-1,3-benzoxazol-2-one |
| InChIKey | IRGRAVNDWCDPML-UHFFFAOYSA-N |
| SMILES | CC(C)N1C2=C(C=CC(=C2)Br)OC1=O |
Computed by PubChem (NCBI)