Products 1802251-49-5
CAS 1802251-49-5 appears in our catalog under these names: Methyl 5,6-dichloropyrazine-2-carboxylate, 95%, Methyl 5,6-Dichloropyrazine-2-Carboxylate, 98%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
Methyl 5,6-dichloropyrazine-2-carboxylate (CAS 1802251-49-5) is a chemical compound with the molecular formula C6H4Cl2N2O2 and a molecular weight of 207.01 g/mol. IUPAC name: methyl 5,6-dichloropyrazine-2-carboxylate. InChIKey: QMXSOVCXPDCBMT-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N2O2 |
|---|---|
| Molecular weight | 207.01 g/mol |
| IUPAC name | methyl 5,6-dichloropyrazine-2-carboxylate |
| InChIKey | QMXSOVCXPDCBMT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=C(C(=N1)Cl)Cl |
Computed by PubChem (NCBI)