Products 1802423-98-8
CAS 1802423-98-8 is the registry number for (R)-2-(2-Nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-7-yl)ethan-1-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(7R)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-7-yl]ethanol (CAS 1802423-98-8) is a chemical compound with the molecular formula C8H11N3O4 and a molecular weight of 213.19 g/mol. IUPAC name: 2-[(7R)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-7-yl]ethanol. InChIKey: WLQVCGBLMLWGED-ZCFIWIBFSA-N.
| Molecular formula | C8H11N3O4 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | 2-[(7R)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-7-yl]ethanol |
| InChIKey | WLQVCGBLMLWGED-ZCFIWIBFSA-N |
| SMILES | C1CN2C=C(N=C2O[C@H]1CCO)[N+](=O)[O-] |
Computed by PubChem (NCBI)