Products 1802889-44-6
CAS 1802889-44-6 is the registry number for 4-Cyclopropylphenylboronic Acid-d4. Offered by: TRC. Available pack sizes: 25mg.
(4-cyclopropyl-2,3,5,6-tetradeuteriophenyl)boronic acid (CAS 1802889-44-6) is a chemical compound with the molecular formula C9H11BO2 and a molecular weight of 166.02 g/mol. IUPAC name: (4-cyclopropyl-2,3,5,6-tetradeuteriophenyl)boronic acid. InChIKey: YNLGFXOBRXSMJZ-LNFUJOGGSA-N.
| Molecular formula | C9H11BO2 |
|---|---|
| Molecular weight | 166.02 g/mol |
| IUPAC name | (4-cyclopropyl-2,3,5,6-tetradeuteriophenyl)boronic acid |
| InChIKey | YNLGFXOBRXSMJZ-LNFUJOGGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1B(O)O)[2H])[2H])C2CC2)[2H] |
Computed by PubChem (NCBI)