Products 1802940-41-5
CAS 1802940-41-5 is the registry number for ethyl 2-nitrilo-3-((4-(trifluoromethoxy)phenyl)amino)prop-2-enoate. Offered by: Biosynth. Available pack sizes: 250mg.
Ethyl (E)-2-cyano-3-[4-(trifluoromethoxy)anilino]prop-2-enoate (CAS 1802940-41-5) is a chemical compound with the molecular formula C13H11F3N2O3 and a molecular weight of 300.23 g/mol. IUPAC name: ethyl (E)-2-cyano-3-[4-(trifluoromethoxy)anilino]prop-2-enoate. InChIKey: CXPFQBSAGAGTAJ-CMDGGOBGSA-N.
| Molecular formula | C13H11F3N2O3 |
|---|---|
| Molecular weight | 300.23 g/mol |
| IUPAC name | ethyl (E)-2-cyano-3-[4-(trifluoromethoxy)anilino]prop-2-enoate |
| InChIKey | CXPFQBSAGAGTAJ-CMDGGOBGSA-N |
| SMILES | CCOC(=O)/C(=C/NC1=CC=C(C=C1)OC(F)(F)F)/C#N |
Computed by PubChem (NCBI)