Products 1803286-27-2
CAS 1803286-27-2 is the registry number for Tasimelteon Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.
N-[[(1R,2R)-2-(3-oxo-1-benzofuran-4-yl)cyclopropyl]methyl]propanamide (CAS 1803286-27-2) is a chemical compound with the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. IUPAC name: N-[[(1R,2R)-2-(3-oxo-1-benzofuran-4-yl)cyclopropyl]methyl]propanamide. InChIKey: VMKACYHRPYYTIK-GXSJLCMTSA-N.
| Molecular formula | C15H17NO3 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | N-[[(1R,2R)-2-(3-oxo-1-benzofuran-4-yl)cyclopropyl]methyl]propanamide |
| InChIKey | VMKACYHRPYYTIK-GXSJLCMTSA-N |
| SMILES | CCC(=O)NC[C@@H]1C[C@H]1C2=C3C(=O)COC3=CC=C2 |
Computed by PubChem (NCBI)